- EDTMP
-
- $0.00 / 1kg
-
2026-05-15
- CAS:1429-50-1
- Min. Order: 1kg
- Purity: 30%
- Supply Ability: 20MT
|
| | Ethylenebis(nitrilodimethylene)tetraphosphonic acid Basic information |
| | Ethylenebis(nitrilodimethylene)tetraphosphonic acid Chemical Properties |
| Melting point | 247 °C | | Boiling point | 878.7±75.0 °C(Predicted) | | density | 1.993±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Aqueous Base (Slightly) | | pka | 0.13±0.10(Predicted) | | form | Solid | | color | White | | Water Solubility | 19.6g/L at 20℃ | | InChI | InChI=1S/C6H20N2O12P4/c9-21(10,11)3-7(4-22(12,13)14)1-2-8(5-23(15,16)17)6-24(18,19)20/h1-6H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) | | InChIKey | NFDRPXJGHKJRLJ-UHFFFAOYSA-N | | SMILES | P(=O)(O)(O)CN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O | | LogP | -4.1 | | CAS DataBase Reference | 1429-50-1(CAS DataBase Reference) | | EPA Substance Registry System | Ethylenediamine tetrakis(methylene phosphonic acid) (1429-50-1) |
| | Ethylenebis(nitrilodimethylene)tetraphosphonic acid Usage And Synthesis |
| Uses | Ethylenediaminetetra(methylenephosphonic acid) is a nitrogenous polyphosphonic acid chelator is able to form complexes with various metal ions. | | Flammability and Explosibility | Not classified |
| | Ethylenebis(nitrilodimethylene)tetraphosphonic acid Preparation Products And Raw materials |
|