|
|
| | Z-GLY-PRO-GLY-GLY-PRO-ALA-OH Basic information |
| Product Name: | Z-GLY-PRO-GLY-GLY-PRO-ALA-OH | | Synonyms: | N-[1-[N-[N-[1-[N-[(phenylmethoxy)carbonyl]glycyl]-L-prolyl]glycyl]glycyl]-L-prolyl]-L-alanine;2-({1-[2-(2-{[1-(2-BENZYLOXYCARBONYLAMINO-ACETYL)-PYRROLIDINE-2-CARBONYL]-AMINO}-ACETYLAMINO)-ACETYL]-PYRROLIDINE-2-CARBONYL}-AMINO)-PROPIONIC ACID;Collagenase-Substrate (for quantitative Collagenase-Determination);2-((1-[2-(2-([1-(2-BENZYLOXYCARBONYLAMINO-ACETYL)-PYRROLIDINE-2-CARBONYL]-AMINO)-ACETYLAMINO)-ACETYL]-PYRROLIDINE-2-CARBONYL)-AMINO)-PROPIONIC ACID;N-CBZ-GLY-PRO-GLY-GLY-PRO-ALA;N-carbobenzoxyglycyl-prolyl-glycyl-glycyl-prolyl-alanine;N-CBZ-glycyl-L-prolyl-glycyl-glycyl-L-prolyl-L-alanine;Z-Gly-Pro-Gly-Gly-Pro-Ala | | CAS: | 13075-38-2 | | MF: | C27H36N6O9 | | MW: | 588.61 | | EINECS: | 235-973-2 | | Product Categories: | | | Mol File: | 13075-38-2.mol |  |
| | Z-GLY-PRO-GLY-GLY-PRO-ALA-OH Chemical Properties |
| Boiling point | 1044.7±65.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.70±0.10(Predicted) | | form | powder | | BRN | 6039452 | | Sequence | Cbz-Gly-Pro-Gly-Gly-Pro-Ala-OH | | InChIKey | YMMPZCZOLKBHAP-IHPCNDPISA-N | | SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)CNC(=O)[C@@H]2CCCN2C(=O)CNC(=O)OCc3ccccc3)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-GLY-PRO-GLY-GLY-PRO-ALA-OH Usage And Synthesis |
| Uses | Z-Gly-Pro-Gly-Gly-Pro-Ala-OH is a collagenase substrate that induces planulae to settle[1]. | | References | [1] William K. Fitt, et al. Different Physiology in the Jellyfish Cassiopea xamachana and C. frondosa in Florida Bay. Oceans 2021, 2(4), 811-821. |
| | Z-GLY-PRO-GLY-GLY-PRO-ALA-OH Preparation Products And Raw materials |
|