|
|
| | 4-Bromo-N,N-bis(trimethylsilyl)aniline Basic information |
| Product Name: | 4-Bromo-N,N-bis(trimethylsilyl)aniline | | Synonyms: | P-BROMO-N,N-BIS TRIMETHYL SILYL ANILINE;N,N-Bis(trimethylsilyl)-4-bromoaniline;4-Bromo-N,N-bis(trimethylsilyl)aniline 97%;Silanamine, N-(4-bromophenyl)-1,1,1-trimethyl-N-(trimethylsilyl)-;-1,1,1-trimethyl-N-(trimethylsilyl);EOS-60917;DK313;4-Bromo-N,N-bis(trimethylsilyl)aniline | | CAS: | 5089-33-8 | | MF: | C12H22BrNSi2 | | MW: | 316.38 | | EINECS: | | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Protected Amines | | Mol File: | 5089-33-8.mol |  |
| | 4-Bromo-N,N-bis(trimethylsilyl)aniline Chemical Properties |
| Boiling point | 156-158 °C/23 mmHg (lit.) | | density | 1.121 g/mL at 25 °C (lit.) | | refractive index | 1.514 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 5.54±0.50(Predicted) | | Specific Gravity | 1.121 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | InChI=1S/C12H22BrNSi2/c1-15(2,3)14(16(4,5)6)12-9-7-11(13)8-10-12/h7-10H,1-6H3 | | InChIKey | YJYMZGDBOMZWSR-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(C)N(C1=CC=C(Br)C=C1)[Si](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Bromo-N,N-bis(trimethylsilyl)aniline Usage And Synthesis |
| Uses | 4-Bromo-N,N-bis(trimethylsilyl)aniline is an N-protected aryl reagent used in the synthesis of:
- Hydrophilic conjugated porphyrin dimers for one-photon and two-photon photodynamic therapy.
- Functionalized organometallic polymer, poly(ferrocenylsilane).
- Borylanilines such as 4-(dimesitylboryl)aniline and 4-(dimesitylboryl)-3,5-dimethylaniline.
- Silicon-containing oligomeric poly(imido-amides) (PIAs).
|
| | 4-Bromo-N,N-bis(trimethylsilyl)aniline Preparation Products And Raw materials |
|