|
|
| | Ethyl benzo[b]thiophene-2-carboxylate Basic information |
| Product Name: | Ethyl benzo[b]thiophene-2-carboxylate | | Synonyms: | Ethyl 1-benzothiophene-2-carboxylate;RARECHEM AL BI 0483;Benzo[b]thiophene-2-carboxylic acid ethyl ester;1-benzothiophene-2-carboxylic acid ethyl ester;Ethyl benzo[b]thiophene-2-carboxylate | | CAS: | 17890-55-0 | | MF: | C11H10O2S | | MW: | 206.26 | | EINECS: | | | Product Categories: | | | Mol File: | 17890-55-0.mol | ![Ethyl benzo[b]thiophene-2-carboxylate Structure](CAS/GIF/17890-55-0.gif) |
| | Ethyl benzo[b]thiophene-2-carboxylate Chemical Properties |
| Melting point | 36-38 °C | | Boiling point | 130 °C(Press: 0.15 Torr) | | density | 1.231±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H10O2S/c1-2-13-11(12)10-7-8-5-3-4-6-9(8)14-10/h3-7H,2H2,1H3 | | InChIKey | PSLMIXGNCNQQRY-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1C=C(C(OCC)=O)S2 |
| | Ethyl benzo[b]thiophene-2-carboxylate Usage And Synthesis |
| | Ethyl benzo[b]thiophene-2-carboxylate Preparation Products And Raw materials |
|