| Company Name: |
Finetech Industry Limited |
| Tel: |
+86-27-8746-5837 +8619945049750 |
| Email: |
info@finetechnology-ind.com |
| Products Intro: |
Product Name:(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
CAS:474-77-1
Purity:98% Package:1g,10g,25g,100g,500g,1kg
|
|
|
|
|
- Epicholesterol
-
- $1.00 / 1KG
-
2024-08-05
- CAS:474-77-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
|
| | EPICHOLESTEROL Basic information |
| Product Name: | EPICHOLESTEROL | | Synonyms: | EPICHOLESTEROL;5-CHOLESTEN-3-ALPHA-OL;cholest-5-en-3-alpha-ol;3α-Cholesterol;Cholest-5-en-3-ol, (3a)-;EpichoL;(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol;Cholest-5-en-3-ol,(3α)- | | CAS: | 474-77-1 | | MF: | C27H46O | | MW: | 386.65 | | EINECS: | | | Product Categories: | | | Mol File: | 474-77-1.mol |  |
| | EPICHOLESTEROL Chemical Properties |
| Melting point | 141.5° | | alpha | D30 -35° (c = 1 in alcohol) | | Boiling point | 452.8°C (rough estimate) | | density | 0.9610 (rough estimate) | | refractive index | 1.5100 (estimate) | | pka | 15.03±0.70(Predicted) | | InChIKey | HVYWMOMLDIMFJA-DLFILBLINA-N | | SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,29,r| |
| | EPICHOLESTEROL Usage And Synthesis |
| | EPICHOLESTEROL Preparation Products And Raw materials |
|