| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Sodium 4-methylvalerate-1-13C Basic information |
| Product Name: | Sodium 4-methylvalerate-1-13C | | Synonyms: | SODIUM 4-METHYLVALERATE-1-13C, 99 ATOM % 13C;4-methylpentanoic acid-1-13c sodium salt;4-Methylpentanoic acid-1-13C sodium salt, Sodium isocaproate-1-13C;4-methyl(1^{13}C)pentanoate;Sodium 4-methylvalerate-1-13C;Sodium 4-methylvalerate-1-13C | | CAS: | 287111-41-5 | | MF: | C6H11NaO2 | | MW: | 139.15 | | EINECS: | | | Product Categories: | | | Mol File: | 287111-41-5.mol |  |
| | Sodium 4-methylvalerate-1-13C Chemical Properties |
| InChI | 1S/C6H12O2.Na/c1-5(2)3-4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1/i6+1; | | InChIKey | ZTRIBXMDBFDMQW-NWZHYJCUSA-M | | SMILES | [Na+].CC(C)CC[13C]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 21-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Sodium 4-methylvalerate-1-13C Usage And Synthesis |
| | Sodium 4-methylvalerate-1-13C Preparation Products And Raw materials |
|