9-ETHYNYLPHENANTHRENE manufacturers
|
| | 9-ETHYNYLPHENANTHRENE Basic information |
| | 9-ETHYNYLPHENANTHRENE Chemical Properties |
| Melting point | 63-67 °C (lit.) | | Boiling point | 377.7±11.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C16H10/c1-2-12-11-13-7-3-4-9-15(13)16-10-6-5-8-14(12)16/h1,3-11H | | InChIKey | FMKVRRYQWWPOAL-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C(C#C)=C2)=CC=CC=3)=CC=C1 | | CAS DataBase Reference | 32870-98-7 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2902.90.9000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Dam. 1 |
| | 9-ETHYNYLPHENANTHRENE Usage And Synthesis |
| | 9-ETHYNYLPHENANTHRENE Preparation Products And Raw materials |
|