| Company Name: |
Suzhouhongxiong Gold |
| Tel: |
18051745768 |
| Email: |
Suzhouhongxiong@163.com |
|
| | 4,4'-Bis(bromomethyl)biphenyl Basic information |
| Product Name: | 4,4'-Bis(bromomethyl)biphenyl | | Synonyms: | 4,4''-BIS(BROMOMETHYL)BIPHENYL 98%;Bisbromomethylbiphenyl;1-(bromomethyl)-4-[4-(bromomethyl)phenyl]benzene;α,α′-Dibromo-p,p′-bitolyl;4,4'-Bis(bromomethyl)biphenyl >=97.0% (HPLC);4,4'-Bis(bromomethyl;4,4'-Bis(bromomethyl)biphenyl >;1,1'-Biphenyl, 4,4'-bis(bromomethyl)- | | CAS: | 20248-86-6 | | MF: | C14H12Br2 | | MW: | 340.05 | | EINECS: | | | Product Categories: | Biphenyl & Diphenyl ether;Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 20248-86-6.mol |  |
| | 4,4'-Bis(bromomethyl)biphenyl Chemical Properties |
| Melting point | 169.0 to 173.0 °C | | Boiling point | 399.8±37.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 2444585 | | InChI | InChI=1S/C14H12Br2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 | | InChIKey | HMUGRILXVBKBID-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CBr)C=C2)=CC=C(CBr)C=C1 | | CAS DataBase Reference | 20248-86-6 |
| Hazard Codes | C,N | | Risk Statements | 36/37/38-50/53-34-22 | | Safety Statements | 26-36/37/39-61-60-45 | | RIDADR | UN 3261 8 / PGIII | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Corr. 1B |
| | 4,4'-Bis(bromomethyl)biphenyl Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | 4,4''-Bis(bromomethyl)-1,1''-biphenyl is a genotoxic impurity from valsartan antihypertensive drug. |
| | 4,4'-Bis(bromomethyl)biphenyl Preparation Products And Raw materials |
|