|
|
| | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one Basic information |
| Product Name: | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one | | Synonyms: | 2-CHLORO-4-(4-CHLOROPHENOXY)ACETOPHENONE;1-[2-CHLORO-4-(4-CHLOROPHENOXY)PHENYL]-1-ETHANONE;1-[2-CHLORO-4-(4-CHLOROPHENOXY)PHENYL]ETHAN-1-ONE;4-ACETYL-3,4'-DICHLORODIPHENYL ETHER;4'-(4-Chlorophenoxy)-2'-Chloro Acetophenone;2chloro-4(p-chlorophenoxy)acetophenone;4-Acetyl-3,4′-dichlordiphenylether;2-CHLORO-4-(4-CHLOROPHENOXY)-ACETOPHENONE 99+% | | CAS: | 119851-28-4 | | MF: | C14H10Cl2O2 | | MW: | 281.13 | | EINECS: | 601-639-3 | | Product Categories: | Ketones;OLED | | Mol File: | 119851-28-4.mol | ![1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one Structure](CAS/GIF/119851-28-4.gif) |
| | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one Chemical Properties |
| Melting point | 54-56°C | | Boiling point | 369.2±37.0 °C(Predicted) | | density | 1.304±0.06 g/cm3(Predicted) | | vapor pressure | 0-0.001Pa at 20-25℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | color | White to Almost white | | InChI | InChI=1S/C14H10Cl2O2/c1-9(17)13-7-6-12(8-14(13)16)18-11-4-2-10(15)3-5-11/h2-8H,1H3 | | InChIKey | BDTJIVUVQRVLLJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC2=CC=C(Cl)C=C2)C=C1Cl)C | | LogP | 4.52 at 25℃ | | CAS DataBase Reference | 119851-28-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | Hazard Note | Irritant | | HS Code | 2914790090 |
| | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one Usage And Synthesis |
| Chemical Properties | White or off-white crystals | | Uses | This compound serves as a reactant in the prepn. of a fungicide that targets plant pathogenic fungi. |
| | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one Preparation Products And Raw materials |
|