4-(4-CHLOROPHENOXY)BENZALDEHYDE manufacturers
|
| | 4-(4-CHLOROPHENOXY)BENZALDEHYDE Basic information |
| | 4-(4-CHLOROPHENOXY)BENZALDEHYDE Chemical Properties |
| Melting point | 54-58 °C | | Boiling point | 181 °C / 2.5mmHg | | density | 1.266±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | 1S/C13H9ClO2/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12/h1-9H | | InChIKey | BLCXBCYVCDPFEU-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 | | CAS DataBase Reference | 61343-99-5(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-43-51/53 | | Safety Statements | 26-36/37-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HazardClass | 9 | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 4-(4-CHLOROPHENOXY)BENZALDEHYDE Usage And Synthesis |
| | 4-(4-CHLOROPHENOXY)BENZALDEHYDE Preparation Products And Raw materials |
|