| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile Basic information |
| | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile Chemical Properties |
| Melting point | 110-115 °C (lit.) | | Boiling point | 445.125±47.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.164±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | solid | | BRN | 3006152 | | InChI | 1S/C17H14N2O4/c1-21-15-9-7-13(8-10-15)12-22-17(20)23-19-16(11-18)14-5-3-2-4-6-14/h2-10H,12H2,1H3/b19-16- | | InChIKey | IPRBOQUKBZNCAG-MNDPQUGUSA-N | | SMILES | COc1ccc(COC(=O)O\N=C(\C#N)c2ccccc2)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile Usage And Synthesis |
| Uses | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile (MOZ-ON) is suitable for use in the synthesis of biotinylated ampicillin sulfone, a bifunctional mechanism-based inhibitor for the selection of active site serine β-lactamases. | | General Description | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile (MOZ-ON) is an organic building block. |
| | 2-(4-Methoxybenzyloxycarbonyloxyimino)-2-phenylacetonitrile Preparation Products And Raw materials |
|