| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
Bis(trimethylstannyl)acetylene manufacturers
|
| | Bis(trimethylstannyl)acetylene Basic information |
| | Bis(trimethylstannyl)acetylene Chemical Properties |
| Melting point | 59-61 °C (lit.) | | Boiling point | 97-98 °C(Press: 16 Torr) | | Fp | 185 °F | | storage temp. | Flammables area | | form | crystal | | color | white | | Sensitive | air sensitive | | InChI | 1S/C2.6CH3.2Sn/c1-2;;;;;;;;/h;6*1H3;; | | InChIKey | CDIFRACRLLNHOO-UHFFFAOYSA-N | | SMILES | C[Sn](C)(C)C#C[Sn](C)(C)C | | CAS DataBase Reference | 2117-50-2 |
| Hazard Codes | T+,N | | Risk Statements | 26/27/28-50/53 | | Safety Statements | 26-27-28-45-60-61 | | RIDADR | UN 2926 4.1/PG 2 | | WGK Germany | 2 | | HS Code | 29310099 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 Flam. Sol. 1 |
| | Bis(trimethylstannyl)acetylene Usage And Synthesis |
| Chemical Properties | white to beige, crystal powder |
| | Bis(trimethylstannyl)acetylene Preparation Products And Raw materials |
|