|
|
| | 3,3,3-Triphenylpropionic acid Basic information |
| Product Name: | 3,3,3-Triphenylpropionic acid | | Synonyms: | 3,3,3-triphenylpropanoate;3,3,3-TRIPHENYLPROPIONIC ACID;2-TRITYLACETIC ACID;2-TRIPHENYLMETHYLACETIC ACID;TIMTEC-BB SBB007877;TRITYLACETIC ACID;3,3,3-Triphenylpropionic acid,97%;3,3,3-Triphenylpropanoic acid | | CAS: | 900-91-4 | | MF: | C21H18O2 | | MW: | 302.37 | | EINECS: | | | Product Categories: | Carboxylic Acids;Building Blocks;C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;C13 to C42+;Carbonyl Compounds | | Mol File: | 900-91-4.mol |  |
| | 3,3,3-Triphenylpropionic acid Chemical Properties |
| Melting point | 180-182 °C (lit.) | | Boiling point | 433.6±14.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | vapor density | 10.1 (vs air) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.25±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | BRN | 2057448 | | InChI | InChI=1S/C21H18O2/c22-20(23)16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2,(H,22,23) | | InChIKey | XMSJLUKCGWQAHO-UHFFFAOYSA-N | | SMILES | C(CC(=O)O)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1 | | CAS DataBase Reference | 900-91-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3,3,3-Triphenylpropionic acid(900-91-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3,3-Triphenylpropionic acid Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY YELLOW CRYSTALLINE POWDER | | Uses | 3,3,3-Triphenylpropionic acid is used as pharmaceutical intermediates. | | General Description | Reaction of 3,3,3-triphenylpropionic acid with lead tetraacetate in benzene, acetonitrile or chlorobenzene solution has been investigated. |
| | 3,3,3-Triphenylpropionic acid Preparation Products And Raw materials |
|