| Company Name: |
Allmpus Laboratories Pvt Ltd
|
| Tel: |
+91-9518738415 +91-9167862134 |
| Email: |
info@allmpus.com |
| Products Intro: |
Product Name:BECLOMETASONE DIPROPIONATE EP IMPURITY E CAS:887130-68-9 Purity:98.62 Package:Customize Packaging (As per customer requirement in Miligram)
|
|
| | 6±-Chlorobeclomethasone Dipropionate Basic information |
| Product Name: | 6±-Chlorobeclomethasone Dipropionate | | Synonyms: | 6±-Chlorobeclomethasone Dipropionate;Beclomethasone Dipropionate EP Impurity E;Pregna-1,4-diene-3,20-dione, 6,9-dichloro-11-hydroxy-16-methyl-17,21-bis(1-oxopropoxy)-, (6α,11β,16β)-;(6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-dichloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-(propionyloxy)acetyl)-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl propionate;Beclomethasone Impurity 5(Beclometasone Dipropionate EP Impurity E);6α-Chlorobeclomethasone Dipropionate;6a-Chlorobeclomethasone Dipropionate;Beclometasone Propionate EP Impurity E | | CAS: | 887130-68-9 | | MF: | C28H36Cl2O7 | | MW: | 555.49 | | EINECS: | | | Product Categories: | | | Mol File: | 887130-68-9.mol |  |
| | 6±-Chlorobeclomethasone Dipropionate Chemical Properties |
| Melting point | >147°C (dec.) | | Boiling point | 654.9±55.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Dioxane (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.74±0.70(Predicted) | | color | Pale Yellow to Light Yellow | | InChIKey | FWNPVUBGWZQULU-QOWWBSQTNA-N | | SMILES | C([C@]1([C@H](C[C@@]2([H])[C@]3([H])C[C@H](Cl)C4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]12C)C)OC(=O)CC)(=O)COC(=O)CC |&1:1,2,4,6,9,17,19,21,24,r| |
| | 6±-Chlorobeclomethasone Dipropionate Usage And Synthesis |
| Uses | 6α-Chlorobeclomethasone Dipropionate (Beclomethasone Dipropionate EP Impurity E) is an analogue of Beclomethasone Dipropionate (B131030), an antiallergic, antiasthmatic (inhalate). Anti-inflammatory (topical). |
| | 6±-Chlorobeclomethasone Dipropionate Preparation Products And Raw materials |
|