|
|
| | Beclomethasone 17-propionate Basic information |
| Product Name: | Beclomethasone 17-propionate | | Synonyms: | Beclomethasone-17-monopropionate reference substance;Beclomethasone Dipropionate EP Impurity H;Beclomethasone Propionate Impurity H(EP);Beclomethasone Dipropionate impurity 5/Beclomethasone Dipropionate EP Impurity H/Beclomethasone-17-monopropionate;9-chloro-11beta,17,21-trihydroxy-16beta-methylpregna-1,4-diene-3,20-dione 17-propionate;9-Chloro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione 17-propanoate;9-Chloro-11,21-dihydroxy-16-methyl-17-propionyloxypregna-1,4-diene-3,20-dione;9-Chloro-11β,21-dihydroxy-16β-methyl-17-(1-oxopropoxy)pregna-1,4-diene-3,20-dione | | CAS: | 5534-18-9 | | MF: | C25H33ClO6 | | MW: | 464.98 | | EINECS: | 2268881 | | Product Categories: | Metabolites & Impurities;Steroids | | Mol File: | 5534-18-9.mol |  |
| | Beclomethasone 17-propionate Chemical Properties |
| Melting point | 124-126C | | Boiling point | 608.9±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO: 100 mg/mL (215.06 mM) | | pka | 12.98±0.10(Predicted) | | form | Solid | | color | White to Light Yellow | | InChIKey | OHYGPBKGZGRQKT-MVAAQJHONA-N | | SMILES | C1(=O)C=C2[C@](C)(C=C1)C1(Cl)[C@]([H])([C@@]3([H])[C@@](C[C@@H]1O)(C)[C@@](OC(=O)CC)(C(=O)CO)[C@@H](C)C3)CC2 |&1:4,10,12,14,16,19,29,r| |
| | Beclomethasone 17-propionate Usage And Synthesis |
| Description | Beclomethasone 17-propionate is a glucocorticoid receptor agonist and an active metabolite of the glucocorticoid prodrug beclomethasone dipropionate. It can effectively inhibit cytokine production in lung macrophages of chronic obstructive pulmonary disease (COPD) and can be used in the study of diseases related to respiratory inflammation. | | Chemical Properties | Light Yellow Solid | | Uses | Active metabolite of Beclomethasone Dipropionate (BDP). |
| | Beclomethasone 17-propionate Preparation Products And Raw materials |
|