H-Glu-Tyr-OH manufacturers
- H-GLU-TYR-OH
-
- $1.00
-
2024-07-25
- CAS:3422-39-7
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | H-Glu-Tyr-OH Basic information |
| Product Name: | H-Glu-Tyr-OH | | Synonyms: | L-ALPHA-GLUTAMYL-L-TYROSINE;ALPHA-L-GLU-L-TYR;4-amino-5-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid;H2N-Glu-Tyr-COOH;EY;H-Glu-Tyr-OH | | CAS: | 3422-39-7 | | MF: | C14H18N2O6 | | MW: | 310.3 | | EINECS: | | | Product Categories: | | | Mol File: | 3422-39-7.mol |  |
| | H-Glu-Tyr-OH Chemical Properties |
| Melting point | 186°C | | storage temp. | -15°C | | form | powder or crystals | | Sequence | Glu-Tyr | | Major Application | (Metabolomics research) | | InChI | 1S/C14H18N2O6/c15-10(5-6-12(18)19)13(20)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,20)(H,18,19)(H,21,22) | | InChIKey | YSWHPLCDIMUKFE-UHFFFAOYSA-N | | SMILES | N(C(Cc1ccc(cc1)O)C(=O)O)C(=O)C(N)CCC(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | H-Glu-Tyr-OH Usage And Synthesis |
| Uses | H-Glu-Tyr-OH is an Angiotensin-converting enzyme (ACE) inhibitory peptide derived from food proteins widely reported for hypertension treatment. | | Definition | ChEBI: Alpha-Glutamyl-Tyrosine is a dipeptide. |
| | H-Glu-Tyr-OH Preparation Products And Raw materials |
|