|
|
| | 5-Cyanothiophene-2-boronic acid Basic information |
| | 5-Cyanothiophene-2-boronic acid Chemical Properties |
| Melting point | 175 °C | | Boiling point | 369.3±52.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | Powder | | pka | 7.27±0.53(Predicted) | | color | Pink to beige | | Water Solubility | insoluble | | InChI | InChI=1S/C5H4BNO2S/c7-3-4-1-2-5(10-4)6(8)9/h1-2,8-9H | | InChIKey | ZEOMEPSYIIQIND-UHFFFAOYSA-N | | SMILES | B(C1SC(C#N)=CC=1)(O)O | | CAS DataBase Reference | 305832-67-1(CAS DataBase Reference) |
| | 5-Cyanothiophene-2-boronic acid Usage And Synthesis |
| Chemical Properties | Pink to beige powder |
| | 5-Cyanothiophene-2-boronic acid Preparation Products And Raw materials |
|