| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Phenylacetylene-d6
CAS:25837-47-2
Remarks:CS-C-02691
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Phenylacetylene-d6
CAS:25837-47-2
Purity:95 atom % D Package:100MG Remarks:513946-100MG
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:Phenylacetylene D6
CAS:25837-47-2
Remarks:CS-BX-00366
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Phenylacetylene-d6 95 atom % D
CAS:25837-47-2
Purity:99% (CP) Package:100mg Remarks:NULL
|
|
| | PHENYLACETYLENE-D6 Basic information |
| Product Name: | PHENYLACETYLENE-D6 | | Synonyms: | ETHYNYLBENZENE-D6;PHENYLACETYLENE-D6, 95 ATOM % D;95atom%d;PHENYLACETYLENE-D6;Phenylacetylene-d6 | | CAS: | 25837-47-2 | | MF: | C8D6 | | MW: | 108.17 | | EINECS: | | | Product Categories: | | | Mol File: | 25837-47-2.mol |  |
| | PHENYLACETYLENE-D6 Chemical Properties |
| Boiling point | 142-144 °C(lit.) | | density | 0.984 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.457(lit.) | | Fp | 88 °F | | InChI | 1S/C8H6/c1-2-8-6-4-3-5-7-8/h1,3-7H/i1D,3D,4D,5D,6D,7D | | InChIKey | UEXCJVNBTNXOEH-HLGHPJLRSA-N | | SMILES | [2H]C#Cc1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| Hazard Codes | Xn | | Risk Statements | 10-36/37/38-40-65-36/38 | | Safety Statements | 16-26-36/37/39-45-62-36-23 | | RIDADR | UN 3295 3/PG 3 | | WGK Germany | 1 | | RTECS | DA0780000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1B |
| | PHENYLACETYLENE-D6 Usage And Synthesis |
| Uses | Phenylacetylene-d6 (CAS# 25837-47-2) is a useful isotopically labeled research compound. |
| | PHENYLACETYLENE-D6 Preparation Products And Raw materials |
|