| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 1-Pyrenyldiazomethane Basic information |
| Product Name: | 1-Pyrenyldiazomethane | | Synonyms: | PYRENE, 1-(DIAZOMETHYL)-;1-Pyrenyldiazomethan;1-Pyrenyldiazomethane, Pyrene, 1-(diazomethyl)-;1-(Diazomethyl)pyrene;Pyren-1-yldiazomethane;PDAM [1-PyrenyldiazoMethane];PEIBAWRLFPGPAT-UHFFFAOYSA-N;PDAM【P6863】 | | CAS: | 78377-23-8 | | MF: | C17H10N2 | | MW: | 242.27 | | EINECS: | | | Product Categories: | | | Mol File: | 78377-23-8.mol |  |
| | 1-Pyrenyldiazomethane Chemical Properties |
| Melting point | 112℃ | | storage temp. | −20°C | | form | solid | | λmax | 338-344 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C17H10N2/c18-19-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-10H | | InChIKey | PEIBAWRLFPGPAT-UHFFFAOYSA-N | | SMILES | [N-]=[N+]=Cc1ccc2ccc3cccc4ccc1c2c34 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Pyrenyldiazomethane Usage And Synthesis |
| Description | PDAM is a HPLC derivatization fluorescent probe for carboxylic acid detection. | | Uses | PDAM is a fluorescent diazoalkane that is useful as an HPLC derivatization reagent for carboxylic acid detection. Dyes and metabolites. |
| | 1-Pyrenyldiazomethane Preparation Products And Raw materials |
|