|
|
| | 3,5-BIS(TRIFLUOROMETHYL)TOLUENE Basic information |
| Product Name: | 3,5-BIS(TRIFLUOROMETHYL)TOLUENE | | Synonyms: | 3,5-Bis(trifluoromethyl)toluene 98%;3,5-Bis(trifluoromethyl)toluene98%;3,5-ditrifluoromethylbenzyl;1,3-Bis(trifluoromethyl)-5-methylbenzene;3,5-Di(trifluoromethyl)toluene;3,5-BIS(TRIFLUOROMETHYL)TOLUENE;1-METHYL-3,5-BIS-TRIFLUOROMETHYL-BENZENE;Benzene,1-methyl-3,5-bis(trifluoromethyl)- | | CAS: | 75462-61-2 | | MF: | C9H6F6 | | MW: | 228.13 | | EINECS: | | | Product Categories: | | | Mol File: | 75462-61-2.mol |  |
| | 3,5-BIS(TRIFLUOROMETHYL)TOLUENE Chemical Properties |
| Boiling point | 125.9±35.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C9H6F6/c1-5-2-6(8(10,11)12)4-7(3-5)9(13,14)15/h2-4H,1H3 | | InChIKey | WGUXTQDCAZNJIF-UHFFFAOYSA-N | | SMILES | CC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 75462-61-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2902900000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-BIS(TRIFLUOROMETHYL)TOLUENE Usage And Synthesis |
| | 3,5-BIS(TRIFLUOROMETHYL)TOLUENE Preparation Products And Raw materials |
|