| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3,5-Bis(trifluoromethyl)benzyl chloride manufacturers
|
| | 3,5-Bis(trifluoromethyl)benzyl chloride Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)benzyl chloride | | Synonyms: | 1-CHLOROMETHYL-3,5-BIS(TRIFLUOROMETHYL)BENZENE;3,5-Bis(trifluoromethyl)benzyl chloride 99%;3,5-Bis(trifluoromethyl)benzylchloride99%;3,5-Bis(trifluoromethyl)-1-(chloromethyl)benzene;3,5-DI(TRIFLUOROMETHYL)BENZYL CHLORIDE;3,5-BIS(TRIFLUOROMETHYL)BENZYL CHLORIDE;Benzene, 1-(chloromethyl)-3,5-bis(trifluoromethyl)-;3,5-Bis(trifluoromethyl)benzyl Chloride > | | CAS: | 75462-59-8 | | MF: | C9H5ClF6 | | MW: | 262.58 | | EINECS: | 278-216-1 | | Product Categories: | Fluorine series;Miscellaneous;Fluorides | | Mol File: | 75462-59-8.mol |  |
| | 3,5-Bis(trifluoromethyl)benzyl chloride Chemical Properties |
| Melting point | 29-32 °C(lit.) | | Boiling point | 46°C 3mm | | density | 1.4425 (estimate) | | Fp | 161 °F | | storage temp. | Sealed in dry,2-8°C | | form | powder to lump | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | BRN | 656502 | | InChI | InChI=1S/C9H5ClF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 | | InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N | | SMILES | C(Cl)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 75462-59-8(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl chloride(75462-59-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,5-Bis(trifluoromethyl)benzyl chloride Usage And Synthesis |
| Uses | 3,5-Bis(trifluoromethyl)benzyl chloride has been used in the preparation of 1-(azidomethyl)-3,5-bis-(trifluoromethyl)benzene. 1-(azidomethyl)-3,5-bis-(trifluoromethyl)benzene, in 94% yield by an efficient nucleophilic substitution reaction between 3,5-bis-(trifluoromethyl)benzyl chloride, 4, and sodium azide. | | Uses | 3,5-Bis(trifluoromethyl)benzyl chloride has been used in the preparation of 1-(azidomethyl)-3,5-bis-(trifluoromethyl)benzene. |
| | 3,5-Bis(trifluoromethyl)benzyl chloride Preparation Products And Raw materials |
|