| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Hydroxy-4-iodobenzaldehyde Chemical Properties |
| Melting point | 126-128 | | Boiling point | 252.2±25.0 °C(Predicted) | | density | 2.039±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | pka | 7.79±0.10(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C7H5IO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H | | InChIKey | IHLOHISMHMTTAA-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(I)C(O)=C1 | | CAS DataBase Reference | 135242-71-6(CAS DataBase Reference) |
| | 3-Hydroxy-4-iodobenzaldehyde Usage And Synthesis |
| Synthesis | 3-Hydroxy-2,4,6-triiodobenzaldehyde, dry pyridine, and a catalytic amount of water were added to a dry reaction flask. The resulting mixture was stirred under reflux for 4 hours. After the reaction was complete, the mixture was concentrated under vacuum, and the residue was purified by silica gel column chromatography. The target product, 3-hydroxy-4-iodobenzaldehyde, was obtained by elution with petroleum ether:ethyl acetate = 4:1 (v/v).
 Figure: Synthetic Route of 3-Hydroxy-4-iodobenzaldehyde | | Uses | 3-Hydroxy-4-iodobenzaldehyde is a white to grayish-white solid at room temperature and pressure. It is a benzaldehyde derivative and is oxidized by air over a long period of time to produce corresponding benzoic acid compounds. 3-Hydroxy-4-iodobenzaldehyde is commonly used as an intermediate in pharmaceutical chemistry and organic synthesis and can be used to synthesize herbicides and plant growth regulators. |
| | 3-Hydroxy-4-iodobenzaldehyde Preparation Products And Raw materials |
|