|
|
| | DL-Serine (2,3,3-d3) Basic information |
| Product Name: | DL-Serine (2,3,3-d3) | | Synonyms: | DL-Serine-d3;MTCFGRXMJLQNBG-FUDHJZNOSA-N;[2H3]-DL-Serine;DL-Serine-2,3,3-d3;D3-DL-Serine;DL-Serine (2,3,3-D?, 98%);DL-Serine-2,3,3-d3 (Standard);DL-Serine (2,3,3-d3) | | CAS: | 70094-78-9 | | MF: | C3H4D3NO3 | | MW: | 108.11 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 70094-78-9.mol |  |
| | DL-Serine (2,3,3-d3) Chemical Properties |
| Melting point | >220°C (dec.) | | Boiling point | 394.822±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.416±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Base (Slightly), Water (Slightly) | | form | Solid | | pka | 2.157±0.10(predicted) | | color | White to Off-White | | InChI | 1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/i1D2,2D | | InChIKey | MTCFGRXMJLQNBG-FUDHJZNOSA-N | | SMILES | OC([2H])([2H])C(N)([2H])C(O)=O | | CAS Number Unlabeled | 302-84-1 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | DL-Serine (2,3,3-d3) Usage And Synthesis |
| Uses | Labelled DL-Serine is used in the synthesis of novel tryptoline derivatives as IDO (indoleamine 2,3-Deoxygenase) inhibitors, for potential use in Alzheimer’s treatment. |
| | DL-Serine (2,3,3-d3) Preparation Products And Raw materials |
|