|
|
| | 17ALPHA(H),21ALPHA(H)-HOPANE Basic information |
| Product Name: | 17ALPHA(H),21ALPHA(H)-HOPANE | | Synonyms: | 17alpha(H),21beta(H)-Hopane solution;α-hopan;(17α)-A'-Neogammacerane;(17α)-Hopane;17α-Hopane;17ALPHA(H),21ALPHA(H)-HOPANE;17ALPHA(H),21BETA(H)-HOPANE;A'-Neogammacerane, (17α)- | | CAS: | 13849-96-2 | | MF: | C30H52 | | MW: | 412.73 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 13849-96-2.mol |  |
| | 17ALPHA(H),21ALPHA(H)-HOPANE Chemical Properties |
| Melting point | 156-158 °C | | Boiling point | 457.4±12.0 °C(Predicted) | | density | 0.925±0.06 g/cm3(Predicted) | | Fp | -12℃ | | storage temp. | 2-8°C | | Major Application | food and beverages | | InChIKey | ZRLNBWWGLOPJIC-SUWMKODTSA-N | | SMILES | CC(C)[C@H]1CC[C@@]2(C)[C@@H]1CC[C@]3(C)[C@@H]2CC[C@@H]4[C@@]5(C)CCCC(C)(C)[C@@H]5CC[C@@]34C | | EPA Substance Registry System | A'-Neogammacerane, (17.alpha.)- (13849-96-2) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 1 | | F | 10-23 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 17ALPHA(H),21ALPHA(H)-HOPANE Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | 17ALPHA(H),21ALPHA(H)-HOPANE Preparation Products And Raw materials |
|