Ethyl 5-hydroxy-2-methylindole-3-carboxylate manufacturers
|
| | Ethyl 5-hydroxy-2-methylindole-3-carboxylate Basic information |
| | Ethyl 5-hydroxy-2-methylindole-3-carboxylate Chemical Properties |
| Melting point | 205-208 °C (lit.) | | Boiling point | 360.05°C (rough estimate) | | density | 1.1825 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | color | Off-white to pink | | InChI | 1S/C12H13NO3/c1-3-16-12(15)11-7(2)13-10-5-4-8(14)6-9(10)11/h4-6,13-14H,3H2,1-2H3 | | InChIKey | BSNHKSUAAMJXBB-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1c(C)[nH]c2ccc(O)cc12 | | CAS DataBase Reference | 7598-91-6 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 5-hydroxy-2-methylindole-3-carboxylate Usage And Synthesis |
| Chemical Properties | off-white to light tan crystalline powder | | Uses | Ethyl 5-Hydroxy-2-methyl-1H-indole-3-carboxylate is useful for preparation and study of hypoxia-selective cytotoxicity of indolequinone antitumor agents. | | Uses | Reactant for preparation of:
- Potential anti-inflammatory and analgesic agents
- Histamine-3 receptor inverse agonists for the treatment of obesity
- Tubulin Polymerization Inhibitors
- 4,7-dioxoindole-3-methyl prodrugs
- Antagonists at M4 muscarinic receptors
|
| | Ethyl 5-hydroxy-2-methylindole-3-carboxylate Preparation Products And Raw materials |
|