|
|
| | Hexachlorodisiloxane Basic information |
| Product Name: | Hexachlorodisiloxane | | Synonyms: | 1,1,1,3,3,3-Hexachloropropanedisiloxane;1,3-Dichloro-1,1,3,3-tetrachloropropanedisiloxane;Hexachloropropanedisiloxane;Oxybis(trichlorosilane);hexachloro-disiloxan;Hexachlorodisiloxane,96%;Perchlorodisiloxane;1,1,1,3,3,3-Hexachloro Disiloxane | | CAS: | 14986-21-1 | | MF: | Cl6OSi2 | | MW: | 284.89 | | EINECS: | 239-070-4 | | Product Categories: | Dielectric MaterialsProtection and Derivatization;Silicon-BasedSelf Assembly&Contact Printing;Organic Conductors and Photovoltaics: OFET and OPV Materials;Organic Electronics and Photonics;Protecting and Derivatizing Reagents;Silane Coupling Agents/Adhesion Promoters;Trichlorosilanes | | Mol File: | 14986-21-1.mol |  |
| | Hexachlorodisiloxane Chemical Properties |
| Melting point | <0°C | | Boiling point | 137 °C(lit.) | | density | 1.575 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.428(lit.) | | Fp | 18 °C | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | liquid | | Specific Gravity | 1.575 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | InChI | InChI=1S/Cl6OSi2/c1-8(2,3)7-9(4,5)6 | | InChIKey | QHAHOIWVGZZELU-UHFFFAOYSA-N | | SMILES | [Si](Cl)(Cl)(Cl)O[Si](Cl)(Cl)Cl | | CAS DataBase Reference | 14986-21-1(CAS DataBase Reference) | | EPA Substance Registry System | Disiloxane, hexachloro- (14986-21-1) |
| | Hexachlorodisiloxane Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid |
| | Hexachlorodisiloxane Preparation Products And Raw materials |
|