|
|
| | 1-(2,3-Dichlorophenyl)piperazine hydrochloride Basic information |
| Product Name: | 1-(2,3-Dichlorophenyl)piperazine hydrochloride | | Synonyms: | N-(2,3-DICHLOROPHENYL) PIPERAZINE HCL;1-(2,3-DICHLORPHENYL)-PIPERAZINE HYDROCHLORIDE;1-(2,3-Dichlorophenyl)-piperaz;1-(2,3-DICHLOROPHENYL)PIPERAZINE MONOHYDROCHLORIDE, 98+%;1-(2,3-Dichlorophenyl)piperazine hydrochloride;1-(2,3-Dichlorophenyl)-piperazine monohydrochloride;1-(2,3-Dichlorophenyl)piperazine hydrochloride ,98%;TIMTEC-BB SBB003054 | | CAS: | 119532-26-2 | | MF: | C10H13Cl3N2 | | MW: | 267.58 | | EINECS: | 601-621-5 | | Product Categories: | For Aripiprazol's production;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Piperidines, Piperidones, Piperazines;Piperazines;Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;PiperazinesHeterocyclic Building Blocks;INTERMEDIATESOFARIPIPRAZOLE;Piperaizine;API intermediates;Intermediates of Aripiprazole;119532-26-2 | | Mol File: | 119532-26-2.mol |  |
| | 1-(2,3-Dichlorophenyl)piperazine hydrochloride Chemical Properties |
| Melting point | 243-247 °C | | storage temp. | 2-8°C | | solubility | DMF: 11 mg/ml; DMSO: 16 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): 10 mg/ml | | form | powder to crystal | | color | White to Orange to Green | | Water Solubility | Soluble in water, DMSO and methanol. | | Sensitive | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C10H12Cl2N2.ClH/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14;/h1-3,13H,4-7H2;1H | | InChIKey | CYQFNNSFAGXCEC-UHFFFAOYSA-N | | SMILES | ClC1C(=CC=CC=1N1CCNCC1)Cl.Cl | | CAS DataBase Reference | 119532-26-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 1-(2,3-Dichlorophenyl)piperazine hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | This product is intended for forensic and research purposes and it is an aripiprazole intermediate. | | Uses | Aripiprazole (A771000) intermediate. |
| | 1-(2,3-Dichlorophenyl)piperazine hydrochloride Preparation Products And Raw materials |
|