|
|
| | 2,2,2-Trifluoroethyl perfluorobutylsulfonate Basic information |
| Product Name: | 2,2,2-Trifluoroethyl perfluorobutylsulfonate | | Synonyms: | 2,2,2-TRIFLUOROETHYL NONAFLUOROBUTANESULFONATE;2,2,2-TRIFLUOROETHYL NONAFLUOROBUTANESULPHONATE;2,2,2-TRIFLUOROETHYL PERFLUOROBUTANESULFONATE;2,2,2-TRIFLUOROETHYL PERFLUORO BUTYLSULFONATE;NONAFLUOROBUTANESULFONIC ACID 2,2,2-TRIFLUOROETHYL ESTER;PERFLUOROBUTANESULFONIC ACID 2,2,2-TRIFLUOROETHYL ESTER;TPS;2,2,2-TRIFLUOROETHYL PERFLUOROBUTYL SULF | | CAS: | 79963-95-4 | | MF: | C6H2F12O3S | | MW: | 382.12 | | EINECS: | | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;Organic Building Blocks;Sulfonates/Sulfinates;Sulfur Compounds | | Mol File: | 79963-95-4.mol |  |
| | 2,2,2-Trifluoroethyl perfluorobutylsulfonate Chemical Properties |
| Boiling point | 138-140 | | density | 1.636 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.326(lit.) | | Fp | 160 °F | | storage temp. | Store at room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Light yellow | | Stability: | Hygroscopic, Unstable in Solution | | InChI | 1S/C6H2F12O3S/c7-2(8,9)1-21-22(19,20)6(17,18)4(12,13)3(10,11)5(14,15)16/h1H2 | | InChIKey | KJGYBFLEIPDFNQ-UHFFFAOYSA-N | | SMILES | FC(F)(F)COS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 79963-95-4(CAS DataBase Reference) | | EPA Substance Registry System | 2,2,2-Trifluoroethyl perfluorobutanesulfonate (79963-95-4) |
| Hazard Codes | C,T | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Toxic/Corrosive | | HazardClass | TOXIC, CORROSIVE | | HS Code | 2905599890 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,2,2-Trifluoroethyl perfluorobutylsulfonate Usage And Synthesis |
| Uses | 2,2,2-Trifluoroethyl perfluorobutylsulfonate may be used in the synthesis of 1,2,3,4-tetrahydro-1,1,4,4-tetramethyl-6,7-bis(2,2,2-trifluoro-ethoxy)-naphthalene (TTBN). |
| | 2,2,2-Trifluoroethyl perfluorobutylsulfonate Preparation Products And Raw materials |
|