| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Manganese(II) cyclohexanebutyrate Basic information |
| | Manganese(II) cyclohexanebutyrate Chemical Properties |
| Melting point | 161-163 °C (lit.) | | form | Powder | | color | off-white | | InChI | 1S/2C10H18O2.Mn/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12);/q;;+2/p-2 | | InChIKey | QZKJUBKNJKLMIB-UHFFFAOYSA-L | | SMILES | O=C(CCCC1CCCCC1)O[Mn]OC(=O)CCCC2CCCCC2 | | CAS DataBase Reference | 35542-88-2 | | EPA Substance Registry System | Cyclohexanebutanoic acid, manganese(2+) salt (35542-88-2) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Manganese(II) cyclohexanebutyrate Usage And Synthesis |
| Uses | Manganese standard salt for organic systems. Lot specific assay on label. |
| | Manganese(II) cyclohexanebutyrate Preparation Products And Raw materials |
|