| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,2'-Dithiobis(6-fluorobenzoic acid) Basic information |
| Product Name: | 2,2'-Dithiobis(6-fluorobenzoic acid) | | Synonyms: | BIS(2-CARBOXY-3-FLUOROPHENYL) DISULFIDE;2,2'-Dithiobis(2-nitrobenzoic Acid);Benzoic acid,2,2'-dithiobis[6-fluoro- (9CI);2,2'-Dithiobis(6-fluorobenzoicAcid)>;6,6'-Disulfanediylbis(2-fluorobenzoic acid);2,2′-Dithiobis(6-fluorobenzoic Acid), CAS 147027-64-3;2,2'-Dithiobis(6-fluorobenzoic acid);2,2'-Dithiobis(6-fluorobenzoic acid) | | CAS: | 147027-64-3 | | MF: | C14H8F2O4S2 | | MW: | 342.34 | | EINECS: | | | Product Categories: | | | Mol File: | 147027-64-3.mol |  |
| | 2,2'-Dithiobis(6-fluorobenzoic acid) Chemical Properties |
| Melting point | 265 °C | | Boiling point | 478.7±45.0 °C(Predicted) | | density | 1+-.0.1 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.10±0.36(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C14H8F2O4S2/c15-7-3-1-5-9(11(7)13(17)18)21-22-10-6-2-4-8(16)12(10)14(19)20/h1-6H,(H,17,18)(H,19,20) | | InChIKey | QEONSZINEMHFPH-UHFFFAOYSA-N | | SMILES | C1(C(=CC=CC=1SSC1C=CC=C(F)C=1C(O)=O)F)C(O)=O | | CAS DataBase Reference | 147027-64-3 |
| | 2,2'-Dithiobis(6-fluorobenzoic acid) Usage And Synthesis |
| Uses | A robust, recyclable, multifunctional biobased epoxy vitrimer (ESFB) was prepared by soybean oil and the fluorinated curing agent 2,2′-dithiobis(6-fluorobenzoic acid) (DTFB)[1]. | | References | [1] Wang, X., Fang, Z., Xue, S., Cao, M., Xia, R., Jiasheng Qian. (2025). Fluorine-Based Strong and Recyclable Biobased Epoxy Vitrimer for Application in Carbon Fiber Reinforced Composites. ACS Applied Polymer Materials, 7 24, 16810–16820. https://doi.org/10.1021/acsapm.5c03531
|
| | 2,2'-Dithiobis(6-fluorobenzoic acid) Preparation Products And Raw materials |
|