| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid Basic information |
| | 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid Chemical Properties |
| Melting point | 198-202 °C | | Boiling point | 361.6±37.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 2.12±0.25(Predicted) | | form | powder to crystal | | color | White to Almost white | | Sensitive | Moisture & Light Sensitive | | InChI | InChI=1S/C11H8FNO3/c1-6-9(11(14)15)10(13-16-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15) | | InChIKey | PDEGBONVUJDOFN-UHFFFAOYSA-N | | SMILES | O1C(C)=C(C(O)=O)C(C2=CC=C(F)C=C2)=N1 | | CAS DataBase Reference | 1736-21-6 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid Usage And Synthesis |
| | 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid Preparation Products And Raw materials |
|