|
|
| | 1-(Propanoyl)-piperazine Basic information |
| Product Name: | 1-(Propanoyl)-piperazine | | Synonyms: | Olaparib Impurity 62;1-(PROPIONYL)-PIPERAZINE;1-Propanoylpiperazine, 1-(1-Oxoprop-1-yl)piperazine;1-Propanone,1-(1-piperazinyl)-;1-(piperazin-1-yl)propan-1-one HCl;1-(1-piperazinyl)-1-propanone;N-propionyl piperazine;1-(Piperazin-1-yl)propan-1-one | | CAS: | 76816-54-1 | | MF: | C7H14N2O | | MW: | 142.2 | | EINECS: | | | Product Categories: | piperazines | | Mol File: | 76816-54-1.mol |  |
| | 1-(Propanoyl)-piperazine Chemical Properties |
| Melting point | 55 °C | | Boiling point | 78 °C | | density | 1.006±0.06 g/cm3(Predicted) | | pka | 8.44±0.10(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C7H14N2O/c1-2-7(10)9-5-3-8-4-6-9/h8H,2-6H2,1H3 | | InChIKey | YEQAMPOYHLICPF-UHFFFAOYSA-N | | SMILES | C(N1CCNCC1)(=O)CC |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-41-22 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | WGK 3 | | Hazard Note | Harmful | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 1-(Propanoyl)-piperazine Usage And Synthesis |
| | 1-(Propanoyl)-piperazine Preparation Products And Raw materials |
|