| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2,4,6-Trimethylstyrene manufacturers
- 2,4,6-TRIMETHYLSTYRENE
-
- $1.50
-
2026-05-15
- CAS:769-25-5
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
|
| | 2,4,6-Trimethylstyrene Basic information |
| Product Name: | 2,4,6-Trimethylstyrene | | Synonyms: | VINYLMESITYLENE;1-ethenyl-2,4,6-trimethylbenzene;benzene,2-ethenyl-1,3,5-trimethyl-;Mesitylethylene;Styrene, 2,4,6-trimethyl-;styrene,2,4,6-trimethyl-;1,3,5-TRIMETHYL-2-VINYLBENZENE;2-VINYLMESITYLENE | | CAS: | 769-25-5 | | MF: | C11H14 | | MW: | 146.23 | | EINECS: | 212-205-4 | | Product Categories: | Styrenes;Monomers;Polymer Science;Styrene and Functionalized Styrene Monomers | | Mol File: | 769-25-5.mol |  |
| | 2,4,6-Trimethylstyrene Chemical Properties |
| Melting point | -37°C | | Boiling point | 209 °C (lit.) | | density | 0.906 g/mL at 25 °C (lit.) | | refractive index | 1.5320 | | Fp | 75°C | | storage temp. | 2-8°C | | solubility | Soluble in methanol. | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 1904365 | | InChI | InChI=1S/C11H14/c1-5-11-9(3)6-8(2)7-10(11)4/h5-7H,1H2,2-4H3 | | InChIKey | PDELBHCVXBSVPJ-UHFFFAOYSA-N | | SMILES | C1(C)=CC(C)=CC(C)=C1C=C | | CAS DataBase Reference | 769-25-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 23-36/37/39 | | WGK Germany | 3 | | HS Code | 2902.90.3050 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 2,4,6-Trimethylstyrene Usage And Synthesis |
| Uses | 2,4,6-Trimethylstyrene is used as an intermediate to produce other chemicals like 2-Methoxy-1-(2, 4, 6-trimethyl-phenyl)-ethanone. |
| | 2,4,6-Trimethylstyrene Preparation Products And Raw materials |
|