|
|
| | Propoxylate neopentylene glycol diacrylate Basic information |
| Product Name: | Propoxylate neopentylene glycol diacrylate | | Synonyms: | 2-ethanediyl)],.alpha.,.alpha.’-(2,2-dimethyl-1,3-propanediyl)bis[.omega.-[(1-oxo-2-propenyl)oxy]Poly[oxy(methyl-1;neopentylglycolpropoxylate(1po/oh)diacrylate;poly[oxy(methyl-1,2-ethanediyl)],alpha,alpha’-(2,2-dimethyl-1,3-propanediyl)b;NEOPENTYL GLYCOL PROPOXYLATE (1 PO/OH) D IACRYLATE, AVERAGE MN CA. 328;Polyoxy(methyl-1,2-ethanediyl), .alpha.,.alpha.-(2,2-dimethyl-1,3-propanediyl)bis.omega.-(1-oxo-2-propenyl)oxy-;Neopentylglykol diacrylat, propoxiliert mit 2 mol PO;2,2-Dimethyl-1,3-propanediol diacrylate, propoxylated;Poly[oxy(methyl-1,2-ethanediyl)], α,α'-(2,2-dimethyl- 1,3-propanediyl)bis[ω-[(1-oxo-2-propenyl )oxy]- | | CAS: | 84170-74-1 | | MF: | [H2C=CHCO2(C3H6O)nCH2]2C(CH3)2 | | MW: | 328 | | EINECS: | | | Product Categories: | Polymers;Acrylic Monomers;Monomers;Polyfunctional Acrylics | | Mol File: | Mol File | ![Propoxylate neopentylene glycol diacrylate Structure]() |
| | Propoxylate neopentylene glycol diacrylate Chemical Properties |
| Boiling point | 225 | | density | 1.007 g/mL at 25 °C(lit.) | | refractive index | 1.4464 | | Fp | >230 °F | | form | Liquid | | color | Clear, colorless to slightly yellow | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | 1S/C17H28O6/c1-5-15(18)22-11-7-9-20-13-17(3,4)14-21-10-8-12-23-16(19)6-2/h5-6H,1-2,7-14H2,3-4H3 | | InChIKey | NQGDHQASSFDDLD-UHFFFAOYSA-N | | SMILES | OCCCO.OC(=O)C=C.CC(C)(CO)CO | | EPA Substance Registry System | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.,.alpha.'-(2,2-dimethyl-1,3-propanediyl)bis[.omega.-[(1-oxo-2-propenyl)oxy]- (84170-74-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36 | | RIDADR | 2810 | | WGK Germany | 2 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Propoxylate neopentylene glycol diacrylate Usage And Synthesis |
| Uses | Neopentyl Glycol Propoxylate (1 PO/OH) Diacrylate is used in preparation of activity-controlled photocuring 3D printing resin. | | General Description | Propoxylated Neopentyl Glycol Diacrylate is a specialized chemical compound used primarily in polymer and adhesive applications. Its unique properties make it valuable for various industrial processes. |
| | Propoxylate neopentylene glycol diacrylate Preparation Products And Raw materials |
|