|
|
| | Triamcinolone hexacetonide Basic information |
| Product Name: | Triamcinolone hexacetonide | | Synonyms: | lic16,17-acetalwithacetone,21-(3,3-dimethylbutyrate);tatba;TRIAMCINOLONE HEXACETONIDE;Triamcinolone hexatonide;TRIAMCINOLONEHEXACETONIDE,USP;21-(3,3-Dimethyl-1-oxobutoxy)-9-fluoro-11β-hydroxy-16α,17-[(1-methylethylidene)bis(oxy)]pregna-1,4-diene-3,20-dione;9-Fluoro-11β,21-dihydroxy-16α,17-(isopropylidenebisoxy)pregna-1,4-diene-3,20-dione 21-(3,3-dimethylbutyrate);C08185 | | CAS: | 5611-51-8 | | MF: | C30H41FO7 | | MW: | 532.64 | | EINECS: | 227-031-4 | | Product Categories: | Steroid and Hormone | | Mol File: | 5611-51-8.mol |  |
| | Triamcinolone hexacetonide Chemical Properties |
| Melting point | 295-296° (dec); mp 271-272° (dec) | | alpha | D25 +90±2° (c = 1.13% in chloroform) | | Boiling point | 619.5±55.0 °C(Predicted) | | density | 1.1277 (estimate) | | storage temp. | 2-8°C | | solubility | Practically insoluble in water, sparingly soluble in anhydrous ethanol and in methanol. | | pka | 13.09±0.70(Predicted) | | form | Solid | | color | Fine, white, needle-like crystals | | Major Application | pharmaceutical pharmaceutical small molecule | | InChIKey | TZIZWYVVGLXXFV-FLRHRWPCSA-N | | SMILES | F[C@@]21[C@H]([C@H]4[C@@]([C@@]5(OC(O[C@@H]5C4)(C)C)C(=O)COC(=O)CC(C)(C)C)(C[C@@H]2O)C)CCC3=CC(=O)C=C[C@@]31C | | EPA Substance Registry System | Triamcinolone hexacetonide (5611-51-8) |
| WGK Germany | 3 | | HS Code | 2937220000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Triamcinolone hexacetonide Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder. | | Uses | Triamcinolone Hexacetonide is the Intra-articular glucocorticoid treatment for rheumatoid arthritis. | | Definition | ChEBI: Triamcinolone hexacetonide is a corticosteroid hormone. | | Safety Profile | An experimental teratogen. Otherexperimental reproductive effects. When heated todecomposition it emits toxic fumes of F-. |
| | Triamcinolone hexacetonide Preparation Products And Raw materials |
|