|
|
| | Bromophos Basic information |
| | Bromophos Chemical Properties |
| Melting point | 53-56 °C | | Boiling point | bp0.01 140-142° | | density | 1.704±0.06 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | 0-6°C | | form | solid | | Water Solubility | 40mg/L(room temperature) | | BRN | 1988276 | | Major Application | agriculture
environmental | | InChI | 1S/C8H8BrCl2O3PS/c1-12-15(16,13-2)14-8-4-6(10)5(9)3-7(8)11/h3-4H,1-2H3 | | InChIKey | NYQDCVLCJXRDSK-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1cc(Cl)c(Br)cc1Cl | | CAS DataBase Reference | 2104-96-3(CAS DataBase Reference) | | NIST Chemistry Reference | Bromophos(2104-96-3) | | EPA Substance Registry System | Bromophos (2104-96-3) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 22-50/53 | | Safety Statements | 2-36-60-61-46 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | TE7175000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 | | Hazardous Substances Data | 2104-96-3(Hazardous Substances Data) | | Toxicity | LD50 in male, female rats (mg/kg): 1600, 1730 orally (Gaines) |
| | Bromophos Usage And Synthesis |
| Uses | Bromophos is a pesticide residue that has been found in plants from Southeast Asia. | | Definition | ChEBI: Bromofos is an organic thiophosphate. |
| | Bromophos Preparation Products And Raw materials |
|