|
|
| | Bromophos Basic information |
| | Bromophos Chemical Properties |
| Melting point | 53-56 °C | | Boiling point | bp0.01 140-142° | | density | 1.704±0.06 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | 0-6°C | | form | solid | | Water Solubility | 40mg/L(room temperature) | | BRN | 1988276 | | Henry's Law Constant | 1.0×10-1 mol/(m3Pa) at 25℃, HSDB (2015) | | Major Application | agriculture
environmental | | InChI | 1S/C8H8BrCl2O3PS/c1-12-15(16,13-2)14-8-4-6(10)5(9)3-7(8)11/h3-4H,1-2H3 | | InChIKey | NYQDCVLCJXRDSK-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)Oc1cc(Cl)c(Br)cc1Cl | | CAS DataBase Reference | 2104-96-3(CAS DataBase Reference) | | NIST Chemistry Reference | Bromophos(2104-96-3) | | EPA Substance Registry System | Bromophos (2104-96-3) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 22-50/53 | | Safety Statements | 2-36-60-61-46 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | TE7175000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 | | Hazardous Substances Data | 2104-96-3(Hazardous Substances Data) | | Toxicity | LD50 in male, female rats (mg/kg): 1600, 1730 orally (Gaines) |
| | Bromophos Usage And Synthesis |
| Description | Bromophos is an obsolete organophosphate insecticide. It ha a moderate aqueous solubility and is quite volatile. It is not generally persistent in soil systems but has the potential to leach to groundwater. It is highly toxic to honeybees and aquatic invertebrates but slightly less so to most other species. Bromophos is moderately toxic to mammals if ingested. | | Uses | Bromophos is a pesticide residue that has been found in plants from Southeast Asia. | | Definition | ChEBI: Bromofos is an organic thiophosphate. | | Production Methods | The commercial production of bromophos, involves synthesising the active compound O,O-dimethyl O-(2,5-dichloro-4-bromophenyl) thiophosphate through a multi-step chemical process. It begins with the preparation of a halogenated phenol, specifically, 2,5-dichloro-4-bromophenol, which is then reacted with dimethyl thiophosphoryl chloride under controlled conditions to form the thiophosphate ester. This reaction typically occurs in the presence of a base, such as pyridine or triethylamine, to neutralize the hydrochloric acid by-product. | | Mechanism of action | Broad-spectrum, non-systemic with contact and stomach action. Indirect Acetylcholinesterase (AchE) inhibitor via bromoxon metabolite | | Pesticide Type | Insecticide |
| | Bromophos Preparation Products And Raw materials |
|