|
|
| | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE Basic information | | Reaction |
| Product Name: | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE | | Synonyms: | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE 500MG;(4R)-2-[2-(Diphenylphosphino)phenyl]-4,5-dihydro-4-(1-methylethyl)oxazole,99%e.e.;(R)-(+)-2-[2-(Diphenylphosphino)phenyl]-4-isopropyl-2-oxazoline >=97.0% (CHN);(R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-ISOPROPYL)-4,5-DIHYDROOXAZOLE;(R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE;(R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4,5-DIHYDRO-4-ISOPROPYL-OXAZOLE;(R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-ISOPROPYL-2-OXAZOLINE;(4R)-(+)-4,5-DIHYDRO-2-(2'-(DIPHENYLPHOSPHINO)PHENYL)-4-ISOPROPYLOXAZOLE | | CAS: | 164858-78-0 | | MF: | C24H24NOP | | MW: | 373.43 | | EINECS: | | | Product Categories: | organophosphine ligand;PHOX Series;Chiral Phosphine | | Mol File: | 164858-78-0.mol | ![(R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE Structure](CAS/GIF/164858-78-0.gif) |
| | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE Chemical Properties |
| Melting point | 85-90 °C | | alpha | +44° (c 1.4, CHCl3) | | Boiling point | 492.7±28.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 4.31±0.70(Predicted) | | form | Powder | | color | white | | Optical Rotation | [α]20/D +48±3°, c = 1.4% in chloroform | | Sensitive | air sensitive | | BRN | 8156604 | | InChI | InChI=1S/C24H24NOP/c1-18(2)22-17-26-24(25-22)21-15-9-10-16-23(21)27(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18,22H,17H2,1-2H3/t22-/m0/s1 | | InChIKey | OUQSAXROROGQEE-QFIPXVFZSA-N | | SMILES | O1C[C@@H](C(C)C)N=C1C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 164858-78-0 |
| | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE Usage And Synthesis |
| Reaction | Chiral ligand used in the asymmetric reduction of highly substituted olefins.
Chiral ligand used in the enantioselective Heck reaction. The success of the reaction is due to the fact that the catalytic system does not promote double bond isomerization.
Chiral ligand used in the entantioselective palladium-catalyzed allylic substitution of sodium benzotriazole.
Decarboxylative allylic alkylation.
| | Chemical Properties | White crystalline powder |
| | (R)-(+)-2-[2-(DIPHENYLPHOSPHINO)PHENYL]-4-(1-METHYLETHYL)-4,5-DIHYDROOXAZOLE Preparation Products And Raw materials |
|