| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4,5-Trifluorobenzoyl chloride Basic information |
| Product Name: | 2,4,5-Trifluorobenzoyl chloride | | Synonyms: | AKOS 91963;2,4,5-TRIFLUOROBENZOYL CHLORIDE;TIMTEC-BB SBB006657;2,4,5-Trifluorobenzoyl;2,4,5-Trifluorobenzoyl chloride 99%;2,4,5-Trifluorobenzoylchloride99%;Benzoyl chloride, 2,4,5-trifluoro- (9CI);2,4,5-Trifluorobenzoic acid chloride | | CAS: | 88419-56-1 | | MF: | C7H2ClF3O | | MW: | 194.54 | | EINECS: | 626-182-7 | | Product Categories: | Organic Building Blocks;Carbonyl Chlorides;Phenyls & Phenyl-Het;Miscellaneous;Carbonyl Chlorides;Phenyls & Phenyl-Het;Acid Halides;Carbonyl Compounds;ACIDHALIDE | | Mol File: | 88419-56-1.mol |  |
| | 2,4,5-Trifluorobenzoyl chloride Chemical Properties |
| Boiling point | 85°C 17mm | | density | 1.52 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.498(lit.) | | Fp | 188 °F | | storage temp. | RT, stored under nitrogen | | form | Liquid | | Specific Gravity | 1.520 | | color | Clear colorless | | Sensitive | Lachrymatory | | BRN | 3606259 | | InChI | InChI=1S/C7H2ClF3O/c8-7(12)3-1-5(10)6(11)2-4(3)9/h1-2H | | InChIKey | STBGCAUUOPNJBH-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC(F)=C(F)C=C1F | | CAS DataBase Reference | 88419-56-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 19-21 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163990 |
| | 2,4,5-Trifluorobenzoyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | 2,4,5-Trifluorobenzoyl chloride Preparation Products And Raw materials |
|