|
|
| | 2,6-Dibromoanthracene Chemical Properties |
| Boiling point | 438.8±18.0 °C(Predicted) | | density | 1.768±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Slightly, Heated, Sonicated) | | form | Solid | | color | Light Yellow | | InChI | InChI=1S/C14H8Br2/c15-13-3-1-9-5-12-8-14(16)4-2-10(12)6-11(9)7-13/h1-8H | | InChIKey | BPRGLVVFWRNXEP-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C3C(=C2)C=CC(Br)=C3)=CC=C1Br | | CAS DataBase Reference | 186517-01-1 |
| | 2,6-Dibromoanthracene Usage And Synthesis |
| Appearance | White to Orange to Green powder to crystal | | Uses | 2,6-DIBROMOANTHRACENE is used as OLED intermediates in OLED display material. |
| | 2,6-Dibromoanthracene Preparation Products And Raw materials |
|