|
|
| | Ozagrel Impurity 16 Basic information |
| Product Name: | Ozagrel Impurity 16 | | Synonyms: | Ozagrel Impurity 22;Ozagrel Related impurity 1;cis-Ozagrel;Ozagrel-020-Z;2-Propenoic acid, 3-[4-(1H-imidazol-1-ylmethyl)phenyl]-, (Z)- (9CI);Ozagrel Impurity 16 Monomer;3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoicacid;(Z)-3-(4-((1H-imidazol-1-yl)methyl)phenyl)acrylic acid | | CAS: | 143945-86-2 | | MF: | C13H12N2O2 | | MW: | 228.25 | | EINECS: | | | Product Categories: | | | Mol File: | 143945-86-2.mol |  |
| | Ozagrel Impurity 16 Chemical Properties |
| Boiling point | 468.0±25.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | pka | 4.30±0.10(Predicted) | | InChI | InChI=1S/C13H12N2O2/c16-13(17)6-5-11-1-3-12(4-2-11)9-15-8-7-14-10-15/h1-8,10H,9H2,(H,16,17)/b6-5- | | InChIKey | SHZKQBHERIJWAO-WAYWQWQTSA-N | | SMILES | C(O)(=O)/C=C\C1=CC=C(CN2C=NC=C2)C=C1 |
| | Ozagrel Impurity 16 Usage And Synthesis |
| Uses | Cis-Ozagrel is a thromboxane synthetase inhibitor, an antiplatelet agent. |
| | Ozagrel Impurity 16 Preparation Products And Raw materials |
|