| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
|
| | Cinnamaldehyde diethyl acetal Basic information | | Aroma |
| Product Name: | Cinnamaldehyde diethyl acetal | | Synonyms: | [(E)-3,3-diethoxyprop-1-enyl]benzene;(3,3-diethoxy-1-propenyl)-benzen;1,1-diethoxy-3-phenylprop-2-ene;beta-(diethoxymethyl)styrene;(3,3-diethoxy-1-propenyl)benzene;3-Phenyl-2-propene-1-one diethyl acetal;3-Phenylpropenal diethyl acetal;Ethyl(1-ethoxy-3-phenyl-2-propenyl) ether | | CAS: | 7148-78-9 | | MF: | C13H18O2 | | MW: | 206.28 | | EINECS: | 230-467-8 | | Product Categories: | | | Mol File: | 7148-78-9.mol |  |
| | Cinnamaldehyde diethyl acetal Chemical Properties |
| Boiling point | 126-127 °C(Press: 10 Torr) | | density | 0.984±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Odor | at 100.00 %. spicy cinnamon | | Appearance | Colorless to off-white Liquid | | Odor Type | spicy | | JECFA Number | 648 | | InChI | InChI=1S/C13H18O2/c1-3-14-13(15-4-2)11-10-12-8-6-5-7-9-12/h5-11,13H,3-4H2,1-2H3 | | InChIKey | VYKDEWVAUWARRX-UHFFFAOYSA-N | | SMILES | C1(C=CC(OCC)OCC)=CC=CC=C1 | | LogP | 3.253 (est) | | EPA Substance Registry System | Benzene, (3,3-diethoxy-1-propenyl)- (7148-78-9) |
| | Cinnamaldehyde diethyl acetal Usage And Synthesis |
| Aroma | Faint, but fresh-green, slightly spicy, oily-sweet odor. Taste is mild and oily-sweet, not
nearly as sweet as the aldehyde. | | Physical properties | Almost colorless oily liquid. B.P. 251°C. (very close to that of Cinnamic aldehyde). Sp.Gr. 0.98. Practically insoluble in water, soluble in alcohol and oils. | | Uses | CINNAMALDEHYDE DIETHYL ACETAL is used occasionally in perfume formulations as a modifier and "new" note in modern-aldehydic or spicy-fruity fragrance types. Stable in soap, but does not contribute much
"spice" odor and can not be considered a suitable substitute for the aldehyde. | | Preparation | Cinnamaldehyde diethyl acetal is prepared by using cinnamaldehyde and triethyl orthoformate as raw materials, adding p-toluenesulfonic acid in absolute ethanol, and then heating and refluxing. |
| | Cinnamaldehyde diethyl acetal Preparation Products And Raw materials |
|