- L-Leucine-D3
-
-
2026-05-11
- CAS:87828-86-2
- Purity:
- Supply Ability: 10g
|
| | L-Leucine-5,5,5-d3 Basic information |
| | L-Leucine-5,5,5-d3 Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 225.772±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.036±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly), Water (Slightly, Heated) | | form | Solid | | pka | 2.550±0.21(predicted) | | color | White to Off-White | | Appearance | white powder | | Optical Rotation | [α]25/D +14.5°, c = 2 in 5 M HCl | | InChI | InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/s3/i1D3/t4,5- | | InChIKey | ROHFNLRQFUQHCH-ZPMWTALLNA-N | | SMILES | C([2H])([2H])([2H])C(C)C[C@H](N)C(=O)O |&1:7,r| | | CAS Number Unlabeled | 61-90-5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Leucine-5,5,5-d3 Usage And Synthesis |
| Description | L-leucine-5,5,5-d3 is a stable isotope labeled amino acid L-leucine, is used in the quantitative determination of proteins using mass spectrometry (MS) and as a tracer in metabolic research. | | Uses | L-Leucine-d3 is used as tracers to study human apolipoprotein B metabolism.L-Leucine-d3 acts as a nutrient signal to stimulate protein synthesis. It has also activates the mammalian target of rapamycin kinase that regulates cell growth. | | Uses | Used in the methodology of stable isotope tagging of epitopes (SITE) for identification of virus-induced peptides in vaccine development. | | Definition | ChEBI: L-leucine-d3 is a L-leucine and a deuterated compound. |
| | L-Leucine-5,5,5-d3 Preparation Products And Raw materials |
|