| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3-(4-tert-Butylphenoxy)benzaldehyde CAS:69770-23-6 Purity:98% Package:10G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3-(4-tert-Butylphenoxy)benzaldehyde CAS:69770-23-6 Purity:98% Remarks:B34528
|
|
| | 3-(4-TERT-BUTYLPHENOXY)BENZALDEHYDE Basic information |
| | 3-(4-TERT-BUTYLPHENOXY)BENZALDEHYDE Chemical Properties |
| Boiling point | 152 °C/0.4 mmHg (lit.) | | density | 0.984 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.57(lit.) | | Fp | >230 °F | | form | solid | | InChI | 1S/C17H18O2/c1-17(2,3)14-7-9-15(10-8-14)19-16-6-4-5-13(11-16)12-18/h4-12H,1-3H3 | | InChIKey | YZIHNHLGGMSWAD-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc(Oc2cccc(C=O)c2)cc1 |
| RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1 |
| | 3-(4-TERT-BUTYLPHENOXY)BENZALDEHYDE Usage And Synthesis |
| Uses | 3-(4-tert-Butylphenoxy)benzaldehyde was used in high-throughput parallel synthesis of library compounds for early drug discovery. It was also used in purification platform developed by ArQule that is based on reverse phase high performance liquid chromatography separation and mass directed fractionation. |
| | 3-(4-TERT-BUTYLPHENOXY)BENZALDEHYDE Preparation Products And Raw materials |
|