| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Arbidol Impurity 1 Basic information |
| Product Name: | Arbidol Impurity 1 | | Synonyms: | Arbidol Impurity 1;1H-Indole-3-carboxylic acid, 6-bromo-5-hydroxy-1-methyl-4-[(methylamino)methyl]-2-[(phenylthio)methyl]-, ethyl ester;Arbidol Impurity 53;Demethyl Arbidol;Ethyl 6-bromo-5-hydroxy-1-methyl-4-((methylamino)methyl)-2-((phenylthio)methyl)-1H-indole-3-carboxylate;Ethyl 6-bromo-5-hydroxy-1-methyl-4-((methylamino)methyl)-2-((phenylthio)methyl)-1H-indole-3-carboxylate (Arbidol Impurity);Abidore Impurity 19;Arbidol Impurity G HCl | | CAS: | 1130901-04-0 | | MF: | C21H23BrN2O3S | | MW: | 463.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1130901-04-0.mol |  |
| | Arbidol Impurity 1 Chemical Properties |
| Boiling point | 604.5±55.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | pka | 6.44±0.50(Predicted) | | InChI | InChI=1S/C21H23BrN2O3S/c1-4-27-21(26)19-17(12-28-13-8-6-5-7-9-13)24(3)16-10-15(22)20(25)14(11-23-2)18(16)19/h5-10,23,25H,4,11-12H2,1-3H3 | | InChIKey | JIQJHSYZKOCTIF-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C(CNC)=C(O)C(Br)=C2)C(C(OCC)=O)=C1CSC1=CC=CC=C1 |
| | Arbidol Impurity 1 Usage And Synthesis |
| Uses | Demethyl Arbidol is an impurity of Arbidol Hydrochloride (A766000) which is a medicinal agent for treating viral infections. |
| | Arbidol Impurity 1 Preparation Products And Raw materials |
|