|
|
| | 1,2-Epoxypropane-d6 Basic information |
| Product Name: | 1,2-Epoxypropane-d6 | | Synonyms: | PROPYLENE OXIDE-D6;PROPYLENE-D6 OXIDE;1,2-PROPYLENE OXIDE (D6);1,2-PROPYLENE-D6 OXIDE;1,2-PROPYLENE OXIDE (D6, 98%);2,2,3-trideuterio-3-(trideuteriomethyl)oxirane;PROPYLENE-D6 OXIDE, 98 ATOM % D;[2H6]-(+/-)-1,2-Propylene Oxide | | CAS: | 202468-69-7 | | MF: | C3D6O | | MW: | 64.12 | | EINECS: | | | Product Categories: | | | Mol File: | 202468-69-7.mol |  |
| | 1,2-Epoxypropane-d6 Chemical Properties |
| Melting point | −112 °C(lit.) | | Boiling point | 34 °C(lit.) | | density | 0.916 g/mL at 25 °C | | refractive index | n20/D 1.365(lit.) | | Fp | <−30 °F | | storage temp. | 0-6°C | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | 1S/C3H6O/c1-3-2-4-3/h3H,2H2,1H3/i1D3,2D2,3D | | InChIKey | GOOHAUXETOMSMM-LIDOUZCJSA-N | | SMILES | [2H]C([2H])([2H])C1([2H])OC1([2H])[2H] | | CAS Number Unlabeled | 75-56-9 |
| Hazard Codes | F+,T | | Risk Statements | 45-12-20/21/22-36/37/38-46 | | Safety Statements | 53-45 | | RIDADR | UN 1280 3/PG 1 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Carc. 1B
Eye Irrit. 2
Flam. Liq. 1
Muta. 1B
STOT SE 3 |
| | 1,2-Epoxypropane-d6 Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | 1,2-EPOXYPROPANE-D6 is a labelled Propylene Oxide, used in the synthesis of polyethylene glycol for use in plastics manufacturing. |
| | 1,2-Epoxypropane-d6 Preparation Products And Raw materials |
|