|
|
| | DOTAGA-Anhydride Basic information |
| Product Name: | DOTAGA-Anhydride | | Synonyms: | DOTAGA-Anhydride;1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, 10-(tetrahydro-2,6-dioxo-2H-pyran-3-yl)-;10-(Tetrahydro-2,6-dioxo-2H-pyran-3-yl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid;2,2',2''-(10-(2,6-Dioxotetrahydro-2H-pyran-3-yl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid | | CAS: | 1375475-53-8 | | MF: | C19H30N4O9 | | MW: | 458.46 | | EINECS: | | | Product Categories: | CHELATORS | | Mol File: | 1375475-53-8.mol |  |
| | DOTAGA-Anhydride Chemical Properties |
| Boiling point | 752.4±60.0 °C(Predicted) | | density | 1.356±0.06 g/cm3(Predicted) | | form | Solid | | pka | 2.46±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C19H30N4O9/c24-15(25)11-20-3-5-21(12-16(26)27)7-9-23(14-1-2-18(30)32-19(14)31)10-8-22(6-4-20)13-17(28)29/h14H,1-13H2,(H,24,25)(H,26,27)(H,28,29) | | InChIKey | BYBCIVKIWIFVFD-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCN(C2CCC(=O)OC2=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1 |
| | DOTAGA-Anhydride Usage And Synthesis |
| Uses | DOTAGA-anhydride is a DOTA-based metal chelator that can bind to radionuclides and is used to prepare radionuclide drug conjugates (RDCs). DOTAGA-anhydride can be used to label monoclonal antibodies (mAbs) such as trastuzumab (targeting HER2/neu receptor with an affinity of 5.5 nM) under mild conditions (PBS pH 7.4, 25 °C, 30 minutes) after chelation with indium-111. [111In-DOTAGA]-trastuzumab showed a tumor uptake of 65% ID/g in mice bearing breast cancer BT-474 xenografts 72 hours after injection, which is valuable for SPECT/CT imaging and biodistribution studies. | | IC 50 | RDC Bifunctional Chelator |
| | DOTAGA-Anhydride Preparation Products And Raw materials |
|