|
|
| Product Name: | DIONIN | | Synonyms: | DIONIN;ETHYLMORPHINIUM HYDROCHLORIDE;ETHYLMORPHINE HYDROCHLORIDE | | CAS: | | | MF: | C19H24ClNO3 | | MW: | 349.85 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | DIONIN Chemical Properties |
| InChIKey | ZPPBASOODYCKDP-YZZSNFJZSA-N | | SMILES | [C@@]123CCN(C)[C@]4([H])CC5C=CC(OCC)=C(O[C@@]1([H])[C@H](C=C[C@]24[H])O)C3=5.Cl |
| | DIONIN Usage And Synthesis |
| Chemical Properties | White, crystalline powder; odorless.
Mp approximately 123C (decomposes). Soluble in
water and alcohol; slightly soluble in ether and chloroform. | | Originator | Ethylmorphine,Yick-Vic Chemicals and | | Uses | Medicine (analgesic). | | Manufacturing Process | To a solution of 199 parts of morphinane sodium in 900 parts of methanol was
added a solution of 60 parts of benzene sulfonic acid methylethyl ester. The
mixture was stirred at heating to give the ethylmorphine.
In practice it is usually used as hydrochloride | | Therapeutic Function | Analgesic, Antitussive, Mydriatic | | Hazard | Toxic by ingestion; habit-forming narcotic. |
| | DIONIN Preparation Products And Raw materials |
|