|
|
| | ETHYLMORPHINE Basic information |
| Product Name: | ETHYLMORPHINE | | Synonyms: | 3-O-Ethylmorphine;7,8-didehydro-4,5-alpha-epoxy-3-ethoxy-17-methyl-morphinan-6-alpha-o;7,8-Didehydro-4,5-epoxy-3-ethoxy-17-methyl-morphinan-6-ol hydrochloride dihydrate;Diohin;Dionine;ethyl-morphin;Morphinan-6alpha-ol, 7,8-didehydro-4,5alpha-epoxy-3-ethoxy-17-methyl-;Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-ethoxy-17-methyl-, (5alpha,6alpha)- | | CAS: | 76-58-4 | | MF: | C19H23NO3 | | MW: | 313.4 | | EINECS: | 200-970-7 | | Product Categories: | Aromatics, Chiral Reagents, Pharmaceuticals, Intermediates & Fine Chemicals;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 76-58-4.mol |  |
| | ETHYLMORPHINE Chemical Properties |
| Melting point | 40-42°C | | Boiling point | 453.19°C (rough estimate) | | density | 1.1501 (rough estimate) | | refractive index | 1.5000 (estimate) | | Fp | 9℃ | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | Colourless Solution | | pka | pKa 8.20(50% aq EtOH) (Uncertain) | | Water Solubility | 2.794g/L(20 ºC) | | Major Application | forensics and toxicology | | InChI | 1S/C19H23NO3/c1-3-22-15-7-4-11-10-13-12-5-6-14(21)18-19(12,8-9-20(13)2)16(11)17(15)23-18/h4-7,12-14,18,21H,3,8-10H2,1-2H3/t12-,13+,14-,18-,19-/m0/s1 | | InChIKey | OGDVEMNWJVYAJL-LEPYJNQMSA-N | | SMILES | CCOc1ccc2C[C@@H]3[C@@H]4C=C[C@H](O)[C@@H]5Oc1c2[C@]45CCN3C |
| Hazard Codes | Xn,T,F | | Risk Statements | 22-39/23/24/25-23/24/25-11 | | Safety Statements | 36/37/39-45-36/37-16-7 | | RIDADR | UN 1230 3/PG 2 | | WGK Germany | 3 | | RTECS | QD0850000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | ETHYLMORPHINE Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Originator | Ethylmorphine,Yick-Vic Chemicals and | | Uses | Ethyl Morphine, is an analgesic (narcotic), antitussive, and Mydriatic.
Controlled substance. | | Uses | Analgesic (narcotic); antitussive. Mydriatic.
Controlled substance. | | Definition | ChEBI: Ethylmorphine is a morphinane alkaloid. | | Manufacturing Process | To a solution of 199 parts of morphinane sodium in 900 parts of methanol was
added a solution of 60 parts of benzene sulfonic acid methylethyl ester. The
mixture was stirred at heating to give the ethylmorphine.
In practice it is usually used as hydrochloride | | Therapeutic Function | Analgesic, Antitussive, Mydriatic | | General Description | Ethylmorphine is an opioid analgesic metabolized by the liver into morphine. The drug carries a risk of dependence and abuse. This certified solution standard is suited for LC/MS or GC/MS methods in forensic analysis, clinical toxicology, and urine drug testing. |
| | ETHYLMORPHINE Preparation Products And Raw materials |
|