|
|
| | Metizolam Basic information |
| Product Name: | Metizolam | | Synonyms: | Metizolam;6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 4-(2-chlorophenyl)-2-ethyl-;Metizolam (1.0 mg/mL in Methanol);Metizolam 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 4-(2-chlorophenyl)-2-ethyl-;Metizolam, Desmethyletizolam;Metizolam solution | | CAS: | 40054-68-0 | | MF: | C16H13ClN4S | | MW: | 328.82 | | EINECS: | | | Product Categories: | | | Mol File: | 40054-68-0.mol |  |
| | Metizolam Chemical Properties |
| Melting point | 153-154 °C | | Boiling point | 527.2±60.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | solubility | DMF: 15mg/mL; DMSO: 15mg/mL; DMSO:PBS (pH 7.2) (1:3): 0.25mg/mL | | form | A crystalline solid | | pka | 1.99±0.40(Predicted) | | InChI | InChI=1S/C16H13ClN4S/c1-2-10-7-12-15(11-5-3-4-6-13(11)17)18-8-14-20-19-9-21(14)16(12)22-10/h3-7,9H,2,8H2,1H3 | | InChIKey | NQSSWDKQLVBUQN-UHFFFAOYSA-N | | SMILES | N12C=NN=C1CN=C(C1=CC=CC=C1Cl)C1C=C(CC)SC=12 |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | Metizolam Usage And Synthesis |
| Uses | Metizolam can be used as reactant/reagent in in preparation of thienylazole and thienotriazolodiazepine compounds as cholecystokinin antagonists. It can also be used in biological study of platelet-activating factor antagonist. |
| | Metizolam Preparation Products And Raw materials |
|