|
|
| | 1-Naphthol-3,6-disulfonic acid disodium salt Basic information |
| Product Name: | 1-Naphthol-3,6-disulfonic acid disodium salt | | Synonyms: | RUDOLF GUERCKE ACID DISODIUM SALT HYDRATE;2,7-Naphthalenedisulfonicacid,4-hydroxy-,disodiumsalt;7-naphthalenedisulfonicacid,4-hydroxy-disodiumsalt;VIOLET ACID DISODIUM SALT HYDRATE;DisodiuM 1-Naphthol-3,6-disulfonate Sodium 4-hydroxynaphthalene-2,7-disulfonate;1-HYDROXYNAPHTHALENE-3,6-DISULFONIC ACID DISODIUM SALT;4-HYDROXY-2,7-NAPHTHALENEDISULFONIC ACID, DISODIUM SALT | | CAS: | 20349-39-7 | | MF: | C10H9NaO7S2 | | MW: | 328.28 | | EINECS: | 243-754-8 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 20349-39-7.mol |  |
| | 1-Naphthol-3,6-disulfonic acid disodium salt Chemical Properties |
| Melting point | 300 oC | | Boiling point | 722.44℃[at 101 325 Pa] | | density | 1.816[at 20℃] | | vapor pressure | 0Pa at 25℃ | | Water Solubility | 1000g/L at 25℃ | | InChI | InChI=1S/C10H8O7S2.Na.H/c11-10-5-8(19(15,16)17)4-6-3-7(18(12,13)14)1-2-9(6)10;;/h1-5,11H,(H,12,13,14)(H,15,16,17);; | | InChIKey | SDQRBYFLTAWSKW-UHFFFAOYSA-N | | SMILES | OC1=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=C12.[NaH] | | LogP | -3.99 at 25℃ | | CAS DataBase Reference | 20349-39-7(CAS DataBase Reference) | | EPA Substance Registry System | 2,7-Naphthalenedisulfonic acid, 4-hydroxy-, disodium salt (20349-39-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29089910 |
| | 1-Naphthol-3,6-disulfonic acid disodium salt Usage And Synthesis |
| Chemical Properties | pinkish-grey presscake | | Uses | 1-Naphthol-3,6-disulfonic acid disodium salt is used as an intermediate for dyes and pigments. | | Definition | 1-Naphthol-3,6-Disulfonic Acid Disodium Salt is a sulfonated naphthol derivative used in various industrial applications due to its chemical properties.
| | Flammability and Explosibility | Not classified |
| | 1-Naphthol-3,6-disulfonic acid disodium salt Preparation Products And Raw materials |
|